Eudragits

1 2D Structure

2D Structure

2 Identification

2.1 Computed Descriptors

2.1.1 IUPAC Name

methyl prop-2-enoate;2-methylprop-2-enoic acid

2.1.2 InChI

InChI=1S/2C4H6O2/c1-3-4(5)6-2;1-3(2)4(5)6/h3H,1H2,2H3;1H2,2H3,(H,5,6)

2.1.3 InChI Key

IQSHMXAZFHORGY-UHFFFAOYSA-N

2.1.4 Canonical SMILES

CC(=C)C(=O)O.COC(=O)C=C

2.2 Synonyms

2.2.1 MeSH Synonyms

1. Eudispert

2. Eudragit

3. Eudragit 12,5p

4. Eudragit L

5. Eudragit L 30 D

6. Eudragit L-100

7. Eudragit S

8. Eudragit S-100

9. Methylmethacrylate-methacrylic Acid Copolymer

10. Mma-maa Polymer

11. Pmma-ma

12. Pmma-maa

13. Poly(methylmethacrylate-co-methacrylic Acid)

14. Polymethacrylic Acid Methyl Ester

15. Vitan-2m

2.2.2 Depositor-Supplied Synonyms

1. 26589-39-9

2. Methacrylic Acid-methyl Acrylate Copolymer

3. Schembl261881

4. Dtxsid70181153

2.3 Create Date

2005-08-08

3 Chemical and Physical Properties

Molecular Formula	C₈H₁₂O₄
Molecular Weight	172.18 g/mol
Hydrogen Bond Donor Count	1
Hydrogen Bond Acceptor Count	4
Rotatable Bond Count	3
Exact Mass	172.07355886 g/mol
Monoisotopic Mass	172.07355886 g/mol
Topological Polar Surface Area	63.6 Å²
Heavy Atom Count	12
Formal Charge	0
Complexity	150
Isotope Atom Count	0
Defined Atom Stereocenter Count	0
Undefined Atom Stereocenter Count	0
Defined Bond Stereocenter Count	0
Undefined Bond Stereocenter Count	0
Covalently Bonded Unit Count	2

Technical details about Eudragits, learn more about the structure, uses, toxicity, action, side effects and more