1. 2 Cyanobutylacrylate
2. 2-cyanobutylacrylate
3. 2-cyanobutylacrylates
4. Butyl 2 Cyanacrylate
5. Butyl 2-cyanacrylate
6. Butyl 2-cyanacrylates
7. Butylcyanoacrylate
8. Butylcyanoacrylates
9. Chirurcoll
10. Cyanoacrylate, Polybutyl
11. Cyanoacrylate, Polyisobutyl
12. Cyanoacrylates, Polybutyl
13. Cyanoacrylates, Polyisobutyl
14. Enbucrilate, Homopolymer
15. Enbucrilates
16. Enbucrilates, Homopolymer
17. Enbucrylate
18. Enbucrylates
19. Fimomed
20. Histacryl
21. Histacryls
22. Histoacryl
23. Histoacryl Blue
24. Histoacryl N Blau
25. Histoacryl N-blau
26. Histoacryls
27. Kanokonlit
28. Ligament-fimomed
29. N Butyl 2 Cyanoacrylate
30. N Butyl Cyanoacrylate
31. N-butyl-2-cyanoacrylate
32. N-butyl-2-cyanoacrylates
33. N-butyl-cyanoacrylate
34. N-butyl-cyanoacrylates
35. Nbca Compound
36. Nbca Compounds
37. Poly(isobutyl Cyanoacrylate)
38. Polybutyl Cyanoacrylate
39. Polybutyl Cyanoacrylates
40. Polyisobutyl Cyanoacrylate
41. Polyisobutyl Cyanoacrylates
42. Polyisobutylcyanoacrylate
43. Polyisobutylcyanoacrylates
1. Butyl 2-cyanoacrylate
2. 6606-65-1
3. N-butyl Cyanoacrylate
4. Butyl Cyanoacrylate
5. Histoacryl
6. N-butyl-2-cyanoacrylate
7. Butyl 2-cyanoprop-2-enoate
8. 2-propenoic Acid, 2-cyano-, Butyl Ester
9. Glustitch
10. Medibond
11. Medicryl
12. Periacryl
13. Vetbond
14. F8cep82qnp
15. 2-cyano-2-propenoic Acid Butyl Ester
16. Enbucrilate (inn)
17. 25154-80-7
18. Enbucrilate [inn]
19. Enbucrilato
20. Enbucrilatum
21. Enbucrilate [inn:ban]
22. Unii-f8cep82qnp
23. Enbucrilatum [inn-latin]
24. Enbucrilato [inn-spanish]
25. Butyl 2-cyano-2-propenoate
26. Histoacryl (tn)
27. Einecs 229-552-2
28. Ec 229-552-2
29. Enbucrilate [mart.]
30. Schembl24796
31. Enbucrilate [who-dd]
32. 95% (stabilized With Tbc)
33. Cyanoacrylic Acid N-butyl Ester
34. Chembl2104251
35. Dtxsid5064417
36. Chebi:134778
37. Glxc-10897
38. N-butyl Cyanoacrylate [mi]
39. Mfcd00134196
40. Akos006272156
41. Db12358
42. Ds-7460
43. Hy-107346
44. A8931
45. Cs-0028189
46. Ns00003729
47. D07893
48. A1-01952
49. Q5003173
50. Inchi=1/c8h11no2/c1-3-4-5-11-8(10)7(2)6-9/h2-5h2,1h
Molecular Weight | 153.18 g/mol |
---|---|
Molecular Formula | C8H11NO2 |
XLogP3 | 2.4 |
Hydrogen Bond Donor Count | 0 |
Hydrogen Bond Acceptor Count | 3 |
Rotatable Bond Count | 5 |
Exact Mass | g/mol |
Monoisotopic Mass | g/mol |
Topological Polar Surface Area | 50.1 |
Heavy Atom Count | 11 |
Formal Charge | 0 |
Complexity | 199 |
Isotope Atom Count | 0 |
Defined Atom Stereocenter Count | 0 |
Undefined Atom Stereocenter Count | 0 |
Defined Bond Stereocenter Count | 0 |
Undefined Bond Stereocenter Count | 0 |
Covalently Bonded Unit Count | 1 |
211 to 300 milligrams for an adult human (cyanide salts). (T86)
Organic nitriles are converted into cyanide ions through the action of cytochrome P450 enzymes in the liver. Cyanide is rapidly absorbed and distributed throughout the body. Cyanide is mainly metabolized into thiocyanate by either rhodanese or 3-mercaptopyruvate sulfur transferase. Cyanide metabolites are excreted in the urine. (L96)
LOOKING FOR A SUPPLIER?