1. Also known as:
Sn-heme, Sn protoporphyrin, Gtpl5279, Q27088994, Tin(4+) ion 10,14-bis(2-carboxyethyl)-4,19-diethenyl-5,9,15,20-tetramethyl-21,22,23,24-tetraazapentacyclo[16.2.1.1^{3,6}.1^{8,11}.1^{13,16}]tetracosa-1(20),2,4,6,8,10,12,14,16,18-decaene-21,22,23,24-tetraide
Molecular Formula
C34H32N4O4Sn
Molecular Weight
679.4 g/mol
InChI Key
VWEYNEFKXXWVHZ-IBPJAKCHSA-N
2 Identification
2.1 Computed Descriptors
2.1.1 IUPAC Name
3-[(4Z,10Z,14Z)-18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethylporphyrin-21,22,23,24-tetraid-2-yl]propanoic acid;tin(4+)
2.1.2 InChI
InChI=1S/C34H32N4O4.Sn/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H,39,40)(H,41,42);/q-4;+4/b25-13-,26-13?,27-14?,28-15-,29-14-,30-15?,31-16?,32-16?;
2.1.3 InChI Key
VWEYNEFKXXWVHZ-IBPJAKCHSA-N
2.1.4 Canonical SMILES
CC1=C(C2=CC3=C(C(=C([N-]3)C=C4C(=C(C(=CC5=C(C(=C([N-]5)C=C1[N-]2)C=C)C)[N-]4)C=C)C)C)CCC(=O)O)CCC(=O)O.[Sn+4]
2.1.5 Isomeric SMILES
CC\1=C(C2=CC3=C(C(=C([N-]3)/C=C\4/C(=C(/C(=C/C5=C(C(=C([N-]5)/C=C1\[N-]2)C=C)C)/[N-]4)C=C)C)C)CCC(=O)O)CCC(=O)O.[Sn+4]
2.2 Synonyms
2.2.1 MeSH Synonyms
1. Rbt-9
2. Sn Protoporphyrin
3. Snpp Ix
4. Stannate(2-), (7,12-diethenyl-3,8,13,17-tetramethyl-21h,23h-porphine-2,18-dipropanoato(4-)-n21,n22,n23,n24)-, Dihydrogen, (sp-4-2)-
5. Stannate(2-), Dichloro(7,12-diethenyl-3,8,13,17-tetramethyl-21h,23h-porphine-2,18-
6. Stannous Protoporphyrin
7. Tin-protoporphyrin
2.2.2 Depositor-Supplied Synonyms
1. Sn-heme
2. Sn Protoporphyrin
3. Gtpl5279
4. Q27088994
5. Tin(4+) Ion 10,14-bis(2-carboxyethyl)-4,19-diethenyl-5,9,15,20-tetramethyl-21,22,23,24-tetraazapentacyclo[16.2.1.1^{3,6}.1^{8,11}.1^{13,16}]tetracosa-1(20),2,4,6,8,10,12,14,16,18-decaene-21,22,23,24-tetraide
2.3 Create Date
3 Chemical and Physical Properties
Molecular Weight |
679.4 g/mol |
Molecular Formula |
C34H32N4O4Sn
|
Hydrogen Bond Donor Count | 2 |
---|
Hydrogen Bond Acceptor Count | 8 |
---|
Rotatable Bond Count | 8 |
---|
Exact Mass | 680.144558 g/mol |
---|
Monoisotopic Mass | 680.144558 g/mol |
---|
Topological Polar Surface Area | 78.6 Ų |
---|
Heavy Atom Count | 43 |
---|
Formal Charge | 0 |
---|
Complexity | 1380 |
---|
Isotope Atom Count | 0 |
---|
Defined Atom Stereocenter Count | 0 |
---|
Undefined Atom Stereocenter Count | 0 |
---|
Defined Bond Stereocenter Count | 3 |
---|
Undefined Bond Stereocenter Count | 1 |
---|
Covalently Bonded Unit Count | 2 |
4 Pharmacology and Biochemistry
4.1 MeSH Pharmacological Classification
Enzyme Inhibitors
Compounds or agents that combine with an enzyme in such a manner as to prevent the normal substrate-enzyme combination and the catalytic reaction. (See all compounds classified as Enzyme Inhibitors.)