![Euroapi Company Header](https://www.pharmacompass.com/image/flap/euroapi-corp-ad-w30-desktop-header-1-2gif-57087.gif)
![Euroapi Company Header](https://www.pharmacompass.com/image/flap/euro-api-mob-header-w30gif-19381.gif)
1. 5,5-dimethylcyclohexane-1,3-dione
1. Dimedone
2. 126-81-8
3. 5,5-dimethylcyclohexane-1,3-dione
4. Methone
5. Cyclomethone
6. Medon
7. Dimedon
8. 1,3-cyclohexanedione, 5,5-dimethyl-
9. Methon
10. 5,5-dimethyldihydroresorcinol
11. 5,5-dimethylhydroresorcinol
12. Dimethyldihydroresorcinol
13. 1,1-dimethyl-3,5-diketocyclohexane
14. 1,1-dimethyl-3,5-cyclohexanedione
15. Lu 274
16. 5,5-dimethyl-cyclohexane-1,3-dione
17. Mfcd00001588
18. Nsc 14984
19. B2b5dsx2fc
20. 5,5-dimethyl-1,3-cyclohexandion
21. Nsc-14984
22. 1,5-cyclohexanedione
23. 5,3-cyclohexanedione
24. 5,3-dione
25. 1,5-diketocyclohexane
26. 1, 5,5-dimethyl-
27. Einecs 204-804-4
28. Unii-b2b5dsx2fc
29. Ai3-19939
30. 5,5'-dimethylcyclohexane-1,3-dione
31. Ec 204-804-4
32. Schembl123127
33. Dtxsid8021987
34. 5,5-dimethyl-1,3-cyclohexadione
35. 5,5-dimethyl-1,3cyclohexanedione
36. 5,5-dimethyl-1,3-cyclohexandione
37. 5,5-dimethylcyclohexan-1,3-dione
38. Nsc14984
39. Nsc17544
40. Nsc43759
41. 5,5-dimethyl-1,3-dihydroresorcinol
42. Nsc-17544
43. Nsc-43759
44. Nsc242994
45. Stk365156
46. 5, 5-dimethyl-1,3-cyclohexanedione
47. 5,5-dimethyl-1, 3-cyclohexanedione
48. Akos000119900
49. Am10627
50. Cs-w016456
51. Hy-w015740
52. Nsc-242994
53. Sb15818
54. As-14592
55. Bp-12997
56. Sy010547
57. 5,5-dimethyl-1,3-cyclohexanedione, 95%
58. D0701
59. Ft-0625018
60. En300-19675
61. D70508
62. 5,5-dimethyl-1,3-cyclohexanedione [mi]
63. A805613
64. Q418261
65. 2,2 Dimethyl,1,6 Cyclohexa Dione; Dimedone
66. Q-200991
67. F0001-0386
68. Z104474686
69. Inchi=1/c8h12o2/c1-8(2)4-6(9)3-7(10)5-8/h3-5h2,1-2h
70. 5,5-dimethyl-1,3-cyclohexanedione, For Hplc Derivatization, For The Determination Of Aldehyde Formaldehyde, >=99.0%
Molecular Weight | 140.18 g/mol |
---|---|
Molecular Formula | C8H12O2 |
XLogP3 | 0.8 |
Hydrogen Bond Donor Count | 0 |
Hydrogen Bond Acceptor Count | 2 |
Rotatable Bond Count | 0 |
Exact Mass | g/mol |
Monoisotopic Mass | g/mol |
Topological Polar Surface Area | 34.1 |
Heavy Atom Count | 10 |
Formal Charge | 0 |
Complexity | 162 |
Isotope Atom Count | 0 |
Defined Atom Stereocenter Count | 0 |
Undefined Atom Stereocenter Count | 0 |
Defined Bond Stereocenter Count | 0 |
Undefined Bond Stereocenter Count | 0 |
Covalently Bonded Unit Count | 1 |