![Minakem Generic APIs](https://www.pharmacompass.com/image/flap/minakem-header-desktop-w27gif-57924.gif)
![Minakem Generic APIs](https://www.pharmacompass.com/image/flap/minakem-header-mobile-w27gif-62411.gif)
1. Isopropyl Bromide
1. 75-26-3
2. Isopropyl Bromide
3. Propane, 2-bromo-
4. Isopropylbromide
5. 2-bromo-propane
6. Sec-propyl Bromide
7. 2-bromo Propane
8. Un2344
9. 2-bromopropane-d6
10. R651xov97z
11. Dtxsid7030197
12. Mfcd00000147
13. Ccris 7919
14. Hsdb 623
15. 2-bromopropane, 99%
16. Einecs 200-855-1
17. Unii-r651xov97z
18. I-propylbromide
19. Ai3-18127
20. Iso-propylbromide
21. I-propyl Bromide
22. 2-bromanylpropane
23. 2-propyl Bromide
24. 1-isopropylbromide
25. Iso-propyl Bromide
26. I-prbr
27. Iso-c3h7br
28. 1-bromo-1-methylethane
29. Ec 200-855-1
30. 2-bromopropane [un2344] [flammable Liquid]
31. 2-bromopropane, >=99%
32. Schembl10251
33. Isopropyl Bromide [mi]
34. Chembl451810
35. Dtxcid5010197
36. 2-bromopropane, Analytical Standard
37. Amy37129
38. Tox21_200356
39. Bbl027287
40. Br1118
41. Stl146524
42. Akos000119846
43. Un-2344
44. Cas-75-26-3
45. Ncgc00091451-01
46. Ncgc00091451-02
47. Ncgc00257910-01
48. Vs-08520
49. 2-bromopropane, Purum, >=99.0% (gc)
50. B0639
51. Ft-0611602
52. En300-20069
53. D87619
54. Inchi=1/c3h7br/c1-3(2)4/h3h,1-2h
55. A838364
56. Q209323
57. J-508539
58. F0001-1897
Molecular Weight | 122.99 g/mol |
---|---|
Molecular Formula | C3H7Br |
XLogP3 | 1.8 |
Hydrogen Bond Donor Count | 0 |
Hydrogen Bond Acceptor Count | 0 |
Rotatable Bond Count | 0 |
Exact Mass | g/mol |
Monoisotopic Mass | g/mol |
Topological Polar Surface Area | 0 |
Heavy Atom Count | 4 |
Formal Charge | 0 |
Complexity | 10.8 |
Isotope Atom Count | 0 |
Defined Atom Stereocenter Count | 0 |
Undefined Atom Stereocenter Count | 0 |
Defined Bond Stereocenter Count | 0 |
Undefined Bond Stereocenter Count | 0 |
Covalently Bonded Unit Count | 1 |
Solvents
Liquids that dissolve other substances (solutes), generally solids, without any change in chemical composition, as, water containing sugar. (Grant and Hackh's Chemical Dictionary, 5th ed) (See all compounds classified as Solvents.)
Mutagens
Chemical agents that increase the rate of genetic mutation by interfering with the function of nucleic acids. A clastogen is a specific mutagen that causes breaks in chromosomes. (See all compounds classified as Mutagens.)